C27H30N2O7 — CID 123823842
(4S,4aS,5aR,12aS)-2-acetyl-4-(dimethylamino)-7-[3-(dimethylamino)prop-1-ynyl]-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone (PubChem CID 123823842) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-2-acetyl-4-(dimethylamino)-7-[3-(dimethylamino)prop-1-ynyl]-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4S,4aS,5aR,12aS)-2-acetyl-4-(dimethylamino)-7-[3-(dimethylamino)prop-1-ynyl]-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123823842 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (4S,4aS,5aR,12aS)-2-acetyl-4-(dimethylamino)-7-[3-(dimethylamino)prop-1-ynyl]-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(C#CCN(C)C)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C27H30N2O7/c1-13(30)19-24(33)22(29(4)5)17-12-15-11-16-14(7-6-10-28(2)3)8-9-18(31)21(16)23(32)20(15)26(35)27(17,36)25(19)34/h8-9,15,17,19-20,22,31,36H,10-12H2,1-5H3/t15-,17-,19?,20?,22-,27+/m0/s1 |
| InChIKey | ODICFWZUYGLQOJ-WRSXBOBESA-N |
| XLogP | -0.12 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|