C27H25F2N5O — CID 123823910
5-(2,6-difluorophenyl)-1-(oxan-2-yl)-3-[6-(1,2,3,6-tetrahydropyridin-6-yl)pyrazin-2-yl]indazole (PubChem CID 123823910) has the molecular formula C27H25F2N5O and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-1-(oxan-2-yl)-3-[6-(1,2,3,6-tetrahydropyridin-6-yl)pyrazin-2-yl]indazole.
| Compound Name | 5-(2,6-difluorophenyl)-1-(oxan-2-yl)-3-[6-(1,2,3,6-tetrahydropyridin-6-yl)pyrazin-2-yl]indazole |
|---|---|
| PubChem CID | 123823910 |
| Molecular Formula | C27H25F2N5O |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-(2,6-difluorophenyl)-1-(oxan-2-yl)-3-[6-(1,2,3,6-tetrahydropyridin-6-yl)pyrazin-2-yl]indazole |
| SMILES | Fc1cccc(F)c1-c1ccc2c(c1)c(-c1cncc(C3C=CCCN3)n1)nn2C1CCCCO1 |
| InChI | InChI=1S/C27H25F2N5O/c28-19-6-5-7-20(29)26(19)17-10-11-24-18(14-17)27(33-34(24)25-9-2-4-13-35-25)23-16-30-15-22(32-23)21-8-1-3-12-31-21/h1,5-8,10-11,14-16,21,25,31H,2-4,9,12-13H2 |
| InChIKey | BZUGFLYUGZRSKI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|