About 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine
2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine (PubChem CID 123826437) has the molecular formula C7H8Cl2N2
and a molecular weight of 191.06 g/mol. Its IUPAC name is 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine |
| PubChem CID | 123826437 |
| Molecular Formula | C7H8Cl2N2 |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine |
| SMILES | ClC1=NC(Cl)C(C2CC2)=CN1 |
| InChI | InChI=1S/C7H8Cl2N2/c8-6-5(4-1-2-4)3-10-7(9)11-6/h3-4,6H,1-2H2,(H,10,11) |
| InChIKey | AIPXZKJGSBAFIF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine?
The IUPAC name of 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine (CID 123826437) is 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine.
What is the SMILES notation for 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine?
The canonical SMILES for 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine is ClC1=NC(Cl)C(C2CC2)=CN1.
What is the InChIKey of 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine?
The InChIKey is AIPXZKJGSBAFIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl2N2/c8-6-5(4-1-2-4)3-10-7(9)11-6/h3-4,6H,1-2H2,(H,10,11).
What are the key properties of 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine?
2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine has a molecular weight of 191.06 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-cyclopropyl-1,4-dihydropyrimidine is sourced from PubChem (CID 123826437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).