C6H8Cl2N2 — CID 145438720
2,4-dichloro-5-ethyl-1,4-dihydropyrimidine (PubChem CID 145438720) has the molecular formula C6H8Cl2N2 and a molecular weight of 179.05 g/mol. Its IUPAC name is 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine.
| Compound Name | 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 145438720 |
| Molecular Formula | C6H8Cl2N2 |
| Molecular Weight | 179.05 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine |
| SMILES | CCC1=CNC(Cl)=NC1Cl |
| InChI | InChI=1S/C6H8Cl2N2/c1-2-4-3-9-6(8)10-5(4)7/h3,5H,2H2,1H3,(H,9,10) |
| InChIKey | OYOXRNFPLSPEMP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|