About 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane
2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane (PubChem CID 145438719) has the molecular formula C10H20Cl2N2
and a molecular weight of 239.19 g/mol. Its IUPAC name is 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane.
Molecular Properties
| Compound Name | 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane |
| PubChem CID | 145438719 |
| Molecular Formula | C10H20Cl2N2 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane |
| SMILES | CC.CC.CCC1=CNC(Cl)=NC1Cl |
| InChI | InChI=1S/C6H8Cl2N2.2C2H6/c1-2-4-3-9-6(8)10-5(4)7;2*1-2/h3,5H,2H2,1H3,(H,9,10);2*1-2H3 |
| InChIKey | POGUUUYKKXTSTK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane?
The IUPAC name of 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane (CID 145438719) is 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane.
What is the SMILES notation for 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane?
The canonical SMILES for 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane is CC.CC.CCC1=CNC(Cl)=NC1Cl.
What is the InChIKey of 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane?
The InChIKey is POGUUUYKKXTSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2N2.2C2H6/c1-2-4-3-9-6(8)10-5(4)7;2*1-2/h3,5H,2H2,1H3,(H,9,10);2*1-2H3.
What are the key properties of 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane?
2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane has a molecular weight of 239.19 g/mol, XLogP of 4.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5-ethyl-1,4-dihydropyrimidine;ethane is sourced from PubChem (CID 145438719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).