C6H9ClN2 — CID 90758518
2-chloro-5-ethyl-1,4-dihydropyrimidine (PubChem CID 90758518) has the molecular formula C6H9ClN2 and a molecular weight of 144.60 g/mol. Its IUPAC name is 2-chloro-5-ethyl-1,4-dihydropyrimidine.
| Compound Name | 2-chloro-5-ethyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 90758518 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 2-chloro-5-ethyl-1,4-dihydropyrimidine |
| SMILES | CCC1=CNC(Cl)=NC1 |
| InChI | InChI=1S/C6H9ClN2/c1-2-5-3-8-6(7)9-4-5/h3H,2,4H2,1H3,(H,8,9) |
| InChIKey | MLFXGVFVBDNCLI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|