C17H22N4O9S — CID 123826721
2-[3-[[2-(1-carboxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl]oxy-3-hydroxypropanoic acid (PubChem CID 123826721) has the molecular formula C17H22N4O9S and a molecular weight of 458.45 g/mol. Its IUPAC name is 2-[3-[[2-(1-carboxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl]oxy-3-hydroxypropanoic acid.
| Compound Name | 2-[3-[[2-(1-carboxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl]oxy-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 123826721 |
| Molecular Formula | C17H22N4O9S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-[3-[[2-(1-carboxyethoxyimino)-2-(2-methyl-1,3-thiazol-4-yl)acetyl]amino]-2,2-dimethyl-4-oxoazetidin-1-yl]oxy-3-hydroxypropanoic acid |
| SMILES | Cc1nc(C(=NOC(C)C(=O)O)C(=O)NC2C(=O)N(OC(CO)C(=O)O)C2(C)C)cs1 |
| InChI | InChI=1S/C17H22N4O9S/c1-7(15(25)26)29-20-11(9-6-31-8(2)18-9)13(23)19-12-14(24)21(17(12,3)4)30-10(5-22)16(27)28/h6-7,10,12,22H,5H2,1-4H3,(H,19,23)(H,25,26)(H,27,28) |
| InChIKey | RZKMCGBDRJHWRZ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|