C18H24N4O9S — CID 172962084
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3S)-1-(1-hydroxy-3-oxobutan-2-yl)oxy-2,2-dimethyl-4-oxoazetidin-3-yl]-2-oxopropylidene]amino]oxy-3-hydroxypropanoic acid (PubChem CID 172962084) has the molecular formula C18H24N4O9S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3S)-1-(1-hydroxy-3-oxobutan-2-yl)oxy-2,2-dimethyl-4-oxoazetidin-3-yl]-2-oxopropylidene]amino]oxy-3-hydroxypropanoic acid.
| Compound Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3S)-1-(1-hydroxy-3-oxobutan-2-yl)oxy-2,2-dimethyl-4-oxoazetidin-3-yl]-2-oxopropylidene]amino]oxy-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 172962084 |
| Molecular Formula | C18H24N4O9S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3S)-1-(1-hydroxy-3-oxobutan-2-yl)oxy-2,2-dimethyl-4-oxoazetidin-3-yl]-2-oxopropylidene]amino]oxy-3-hydroxypropanoic acid |
| SMILES | CC(=O)C(CO)ON1C(=O)[C@@H](CC(=O)/C(=N\OC(CO)C(=O)O)c2csc(N)n2)C1(C)C |
| InChI | InChI=1S/C18H24N4O9S/c1-8(25)12(5-23)31-22-15(27)9(18(22,2)3)4-11(26)14(10-7-32-17(19)20-10)21-30-13(6-24)16(28)29/h7,9,12-13,23-24H,4-6H2,1-3H3,(H2,19,20)(H,28,29)/b21-14-/t9-,12?,13?/m1/s1 |
| InChIKey | MDMFIQIWAQRUKM-KGBDJGFSSA-N |
| XLogP | -1.03 |
| TPSA | 201.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|