C12H16N4O6S2 — CID 159487494
[3-[3-(2-amino-1,3-thiazol-4-yl)-3-methylimino-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 159487494) has the molecular formula C12H16N4O6S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is [3-[3-(2-amino-1,3-thiazol-4-yl)-3-methylimino-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [3-[3-(2-amino-1,3-thiazol-4-yl)-3-methylimino-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 159487494 |
| Molecular Formula | C12H16N4O6S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [3-[3-(2-amino-1,3-thiazol-4-yl)-3-methylimino-2-oxopropyl]-2,2-dimethyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | C/N=C(\C(=O)CC1C(=O)N(OS(=O)(=O)O)C1(C)C)c1csc(N)n1 |
| InChI | InChI=1S/C12H16N4O6S2/c1-12(2)6(10(18)16(12)22-24(19,20)21)4-8(17)9(14-3)7-5-23-11(13)15-7/h5-6H,4H2,1-3H3,(H2,13,15)(H,19,20,21)/b14-9- |
| InChIKey | NWDMLUQOJDEIBN-ZROIWOOFSA-N |
| XLogP | 0.07 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|