C13H16N4O9S2 — CID 172958303
(2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(2R,3S)-3-deuterio-2-methyl-4-oxo-1-sulfooxy-2-(trideuteriomethyl)azetidin-3-yl]-2-oxopropylidene]amino]oxy-2-deuterioacetic acid (PubChem CID 172958303) has the molecular formula C13H16N4O9S2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(2R,3S)-3-deuterio-2-methyl-4-oxo-1-sulfooxy-2-(trideuteriomethyl)azetidin-3-yl]-2-oxopropylidene]amino]oxy-2-deuterioacetic acid.
| Compound Name | (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(2R,3S)-3-deuterio-2-methyl-4-oxo-1-sulfooxy-2-(trideuteriomethyl)azetidin-3-yl]-2-oxopropylidene]amino]oxy-2-deuterioacetic acid |
|---|---|
| PubChem CID | 172958303 |
| Molecular Formula | C13H16N4O9S2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | (2S)-2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(2R,3S)-3-deuterio-2-methyl-4-oxo-1-sulfooxy-2-(trideuteriomethyl)azetidin-3-yl]-2-oxopropylidene]amino]oxy-2-deuterioacetic acid |
| SMILES | [2H][C@H](O/N=C(\C(=O)C[C@]1([2H])C(=O)N(OS(=O)(=O)O)[C@]1(C)C([2H])([2H])[2H])c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C13H16N4O9S2/c1-13(2)6(11(21)17(13)26-28(22,23)24)3-8(18)10(16-25-4-9(19)20)7-5-27-12(14)15-7/h5-6H,3-4H2,1-2H3,(H2,14,15)(H,19,20)(H,22,23,24)/b16-10-/t6-/m1/s1/i1D3,4D,6D/t4-,6+,13-/m0 |
| InChIKey | UJQLYSVWMQIJCL-PLXVTGJOSA-N |
| XLogP | -0.54 |
| TPSA | 198.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|