C19H28BrN3O — CID 123827073
1-(4-bromophenyl)-8-(4-methylpentyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 123827073) has the molecular formula C19H28BrN3O and a molecular weight of 394.36 g/mol. Its IUPAC name is 1-(4-bromophenyl)-8-(4-methylpentyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-(4-bromophenyl)-8-(4-methylpentyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 123827073 |
| Molecular Formula | C19H28BrN3O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(4-bromophenyl)-8-(4-methylpentyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CC(C)CCCN1CCC2(CC1)C(=O)NCN2c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H28BrN3O/c1-15(2)4-3-11-22-12-9-19(10-13-22)18(24)21-14-23(19)17-7-5-16(20)6-8-17/h5-8,15H,3-4,9-14H2,1-2H3,(H,21,24) |
| InChIKey | QLYSLWJTILTXKE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |