C17H24ClN3O — CID 123914569
8-butyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 123914569) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 8-butyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-butyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 123914569 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 8-butyl-1-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCCCN1CCC2(CC1)C(=O)NCN2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClN3O/c1-2-3-10-20-11-8-17(9-12-20)16(22)19-13-21(17)15-6-4-14(18)5-7-15/h4-7H,2-3,8-13H2,1H3,(H,19,22) |
| InChIKey | FPBAXETYFUZLEG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |