C20H29NOSi — CID 123827323
N-cyclopenta-1,3-dien-1-yl-N,2,2,3-tetramethyl-3-[methyl(phenyl)silyl]butanamide (PubChem CID 123827323) has the molecular formula C20H29NOSi and a molecular weight of 327.54 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-yl-N,2,2,3-tetramethyl-3-[methyl(phenyl)silyl]butanamide.
| Compound Name | N-cyclopenta-1,3-dien-1-yl-N,2,2,3-tetramethyl-3-[methyl(phenyl)silyl]butanamide |
|---|---|
| PubChem CID | 123827323 |
| Molecular Formula | C20H29NOSi |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-yl-N,2,2,3-tetramethyl-3-[methyl(phenyl)silyl]butanamide |
| SMILES | CN(C(=O)C(C)(C)C(C)(C)[SiH](C)c1ccccc1)C1=CC=CC1 |
| InChI | InChI=1S/C20H29NOSi/c1-19(2,18(22)21(5)16-12-10-11-13-16)20(3,4)23(6)17-14-8-7-9-15-17/h7-12,14-15,23H,13H2,1-6H3 |
| InChIKey | MIFTYPCBFCFPPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|