C16H25NOSi — CID 10612466
1-[(3R,4S)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylpyrrolidin-1-yl]ethanone (PubChem CID 10612466) has the molecular formula C16H25NOSi and a molecular weight of 275.47 g/mol. Its IUPAC name is 1-[(3R,4S)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylpyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4S)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 10612466 |
| Molecular Formula | C16H25NOSi |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[(3R,4S)-3-[[dimethyl(phenyl)silyl]methyl]-4-methylpyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@H](C[Si](C)(C)c2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C16H25NOSi/c1-13-10-17(14(2)18)11-15(13)12-19(3,4)16-8-6-5-7-9-16/h5-9,13,15H,10-12H2,1-4H3/t13-,15-/m1/s1 |
| InChIKey | USONDRHRCWPXSO-UKRRQHHQSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|