C19H31NOSi — CID 86003269
6-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide (PubChem CID 86003269) has the molecular formula C19H31NOSi and a molecular weight of 317.55 g/mol. Its IUPAC name is 6-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide.
| Compound Name | 6-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide |
|---|---|
| PubChem CID | 86003269 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 6-[dimethyl(phenyl)silyl]-N,N-diethylhept-6-enamide |
| SMILES | C=C(CCCCC(=O)N(CC)CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NOSi/c1-6-20(7-2)19(21)16-12-11-13-17(3)22(4,5)18-14-9-8-10-15-18/h8-10,14-15H,3,6-7,11-13,16H2,1-2,4-5H3 |
| InChIKey | WDUQGZYIIXWSDT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|