C19H31NOSi — CID 134950259
(E)-3-[dimethyl(phenyl)silyl]-N,N-diethylhept-2-enamide (PubChem CID 134950259) has the molecular formula C19H31NOSi and a molecular weight of 317.55 g/mol. Its IUPAC name is (E)-3-[dimethyl(phenyl)silyl]-N,N-diethylhept-2-enamide.
| Compound Name | (E)-3-[dimethyl(phenyl)silyl]-N,N-diethylhept-2-enamide |
|---|---|
| PubChem CID | 134950259 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (E)-3-[dimethyl(phenyl)silyl]-N,N-diethylhept-2-enamide |
| SMILES | CCCC/C(=C\C(=O)N(CC)CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NOSi/c1-6-9-13-18(16-19(21)20(7-2)8-3)22(4,5)17-14-11-10-12-15-17/h10-12,14-16H,6-9,13H2,1-5H3/b18-16+ |
| InChIKey | DRQQJDSVTUJDKV-FBMGVBCBSA-N |
| XLogP | 4.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|