C13H21NOSi — CID 11075395
N-[1-[dimethyl(phenyl)silyl]propyl]acetamide (PubChem CID 11075395) has the molecular formula C13H21NOSi and a molecular weight of 235.40 g/mol. Its IUPAC name is N-[1-[dimethyl(phenyl)silyl]propyl]acetamide.
| Compound Name | N-[1-[dimethyl(phenyl)silyl]propyl]acetamide |
|---|---|
| PubChem CID | 11075395 |
| Molecular Formula | C13H21NOSi |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[1-[dimethyl(phenyl)silyl]propyl]acetamide |
| SMILES | CCC(NC(C)=O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H21NOSi/c1-5-13(14-11(2)15)16(3,4)12-9-7-6-8-10-12/h6-10,13H,5H2,1-4H3,(H,14,15) |
| InChIKey | XGJNJZWCBVZADR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|