C12H16F3NOSi — CID 10660014
2-[dimethyl(phenyl)silyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 10660014) has the molecular formula C12H16F3NOSi and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-[dimethyl(phenyl)silyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[dimethyl(phenyl)silyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 10660014 |
| Molecular Formula | C12H16F3NOSi |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[dimethyl(phenyl)silyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C[Si](C)(CC(=O)NCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H16F3NOSi/c1-18(2,10-6-4-3-5-7-10)8-11(17)16-9-12(13,14)15/h3-7H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | LNHBZKVXYSNNAO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|