C25H35NOSi2 — CID 134846474
N-[(4R,5E)-1,2-bis[dimethyl(phenyl)silyl]hepta-2,5-dien-4-yl]acetamide (PubChem CID 134846474) has the molecular formula C25H35NOSi2 and a molecular weight of 421.73 g/mol. Its IUPAC name is N-[(4R,5E)-1,2-bis[dimethyl(phenyl)silyl]hepta-2,5-dien-4-yl]acetamide.
| Compound Name | N-[(4R,5E)-1,2-bis[dimethyl(phenyl)silyl]hepta-2,5-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 134846474 |
| Molecular Formula | C25H35NOSi2 |
| Molecular Weight | 421.73 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[(4R,5E)-1,2-bis[dimethyl(phenyl)silyl]hepta-2,5-dien-4-yl]acetamide |
| SMILES | C/C=C/[C@H](C=C(C[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1)NC(C)=O |
| InChI | InChI=1S/C25H35NOSi2/c1-7-14-22(26-21(2)27)19-25(29(5,6)24-17-12-9-13-18-24)20-28(3,4)23-15-10-8-11-16-23/h7-19,22H,20H2,1-6H3,(H,26,27)/b14-7+,25-19?/t22-/m1/s1 |
| InChIKey | ISGZGNQBHONOSO-PKFYHZMNSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|