C23H33NOSi2 — CID 134846472
N-[(2R)-4,5-bis[dimethyl(phenyl)silyl]pent-3-en-2-yl]acetamide (PubChem CID 134846472) has the molecular formula C23H33NOSi2 and a molecular weight of 395.70 g/mol. Its IUPAC name is N-[(2R)-4,5-bis[dimethyl(phenyl)silyl]pent-3-en-2-yl]acetamide.
| Compound Name | N-[(2R)-4,5-bis[dimethyl(phenyl)silyl]pent-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 134846472 |
| Molecular Formula | C23H33NOSi2 |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | N-[(2R)-4,5-bis[dimethyl(phenyl)silyl]pent-3-en-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C)C=C(C[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H33NOSi2/c1-19(24-20(2)25)17-23(27(5,6)22-15-11-8-12-16-22)18-26(3,4)21-13-9-7-10-14-21/h7-17,19H,18H2,1-6H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | PGRCBABAYVZBCU-LJQANCHMSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|