C13H20FNOSSi — CID 87779567
N-[2-[(4-fluorophenyl)-dimethylsilyl]ethyl]-3-sulfanylpropanamide (PubChem CID 87779567) has the molecular formula C13H20FNOSSi and a molecular weight of 285.46 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)-dimethylsilyl]ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-[(4-fluorophenyl)-dimethylsilyl]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 87779567 |
| Molecular Formula | C13H20FNOSSi |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-[2-[(4-fluorophenyl)-dimethylsilyl]ethyl]-3-sulfanylpropanamide |
| SMILES | C[Si](C)(CCNC(=O)CCS)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H20FNOSSi/c1-18(2,10-8-15-13(16)7-9-17)12-5-3-11(14)4-6-12/h3-6,17H,7-10H2,1-2H3,(H,15,16) |
| InChIKey | SFUPNYCLCFTTQT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|