C14H24N2OSi — CID 86178367
3-[1-[dimethyl(phenyl)silyl]propyl]-1,1-dimethylurea (PubChem CID 86178367) has the molecular formula C14H24N2OSi and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-[1-[dimethyl(phenyl)silyl]propyl]-1,1-dimethylurea.
| Compound Name | 3-[1-[dimethyl(phenyl)silyl]propyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 86178367 |
| Molecular Formula | C14H24N2OSi |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-[1-[dimethyl(phenyl)silyl]propyl]-1,1-dimethylurea |
| SMILES | CCC(NC(=O)N(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H24N2OSi/c1-6-13(15-14(17)16(2)3)18(4,5)12-10-8-7-9-11-12/h7-11,13H,6H2,1-5H3,(H,15,17) |
| InChIKey | JSWYPPNWKMFRHL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|