About 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea
1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea (PubChem CID 134900985) has the molecular formula C18H30N2OSi
and a molecular weight of 318.54 g/mol. Its IUPAC name is 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea.
Molecular Properties
| Compound Name | 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea |
| PubChem CID | 134900985 |
| Molecular Formula | C18H30N2OSi |
| Molecular Weight | 318.54 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea |
| SMILES | C/C=C(/C)N(C(=O)N(C)C)C(CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H30N2OSi/c1-8-15(3)20(18(21)19(4)5)17(9-2)22(6,7)16-13-11-10-12-14-16/h8,10-14,17H,9H2,1-7H3/b15-8- |
| InChIKey | YCDXXROLARLPHL-NVNXTCNLSA-N |
| XLogP | 3.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea?
The IUPAC name of 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea (CID 134900985) is 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea.
What is the SMILES notation for 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea?
The canonical SMILES for 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea is C/C=C(/C)N(C(=O)N(C)C)C(CC)[Si](C)(C)c1ccccc1.
What is the InChIKey of 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea?
The InChIKey is YCDXXROLARLPHL-NVNXTCNLSA-N. The full InChI is InChI=1S/C18H30N2OSi/c1-8-15(3)20(18(21)19(4)5)17(9-2)22(6,7)16-13-11-10-12-14-16/h8,10-14,17H,9H2,1-7H3/b15-8-.
What are the key properties of 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea?
1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea has a molecular weight of 318.54 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-but-2-en-2-yl]-1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethylurea is sourced from PubChem (CID 134900985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).