C17H28N2OSi — CID 10892071
1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethyl-1-[(E)-prop-1-enyl]urea (PubChem CID 10892071) has the molecular formula C17H28N2OSi and a molecular weight of 304.51 g/mol. Its IUPAC name is 1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethyl-1-[(E)-prop-1-enyl]urea.
| Compound Name | 1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethyl-1-[(E)-prop-1-enyl]urea |
|---|---|
| PubChem CID | 10892071 |
| Molecular Formula | C17H28N2OSi |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[1-[dimethyl(phenyl)silyl]propyl]-3,3-dimethyl-1-[(E)-prop-1-enyl]urea |
| SMILES | C/C=C/N(C(=O)N(C)C)C(CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2OSi/c1-7-14-19(17(20)18(3)4)16(8-2)21(5,6)15-12-10-9-11-13-15/h7,9-14,16H,8H2,1-6H3/b14-7+ |
| InChIKey | CZISOVQHCUPRNP-VGOFMYFVSA-N |
| XLogP | 3.44 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|