C15H26N2OSi — CID 86178368
1-[1-[dimethyl(phenyl)silyl]propyl]-1,3,3-trimethylurea (PubChem CID 86178368) has the molecular formula C15H26N2OSi and a molecular weight of 278.47 g/mol. Its IUPAC name is 1-[1-[dimethyl(phenyl)silyl]propyl]-1,3,3-trimethylurea.
| Compound Name | 1-[1-[dimethyl(phenyl)silyl]propyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 86178368 |
| Molecular Formula | C15H26N2OSi |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[1-[dimethyl(phenyl)silyl]propyl]-1,3,3-trimethylurea |
| SMILES | CCC(N(C)C(=O)N(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H26N2OSi/c1-7-14(17(4)15(18)16(2)3)19(5,6)13-11-9-8-10-12-13/h8-12,14H,7H2,1-6H3 |
| InChIKey | OJTZTOHZEKALBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|