C16H30N2O — CID 91227131
benzene;1-tert-butyl-1,3,3-trimethylurea;ethane (PubChem CID 91227131) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is benzene;1-tert-butyl-1,3,3-trimethylurea;ethane.
| Compound Name | benzene;1-tert-butyl-1,3,3-trimethylurea;ethane |
|---|---|
| PubChem CID | 91227131 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | benzene;1-tert-butyl-1,3,3-trimethylurea;ethane |
| SMILES | CC.CN(C)C(=O)N(C)C(C)(C)C.c1ccccc1 |
| InChI | InChI=1S/C8H18N2O.C6H6.C2H6/c1-8(2,3)10(6)7(11)9(4)5;1-2-4-6-5-3-1;1-2/h1-6H3;1-6H;1-2H3 |
| InChIKey | VXVNSELQBRVZGO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |