C42H30Cl2N4 — CID 123828020
2-(2-chlorophenyl)-1-[2-(2-chlorophenyl)-4-hexa-1,3,5-trien-3-yl-5-phenylimidazol-2-yl]-4,5-diphenylimidazole (PubChem CID 123828020) has the molecular formula C42H30Cl2N4 and a molecular weight of 661.64 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[2-(2-chlorophenyl)-4-hexa-1,3,5-trien-3-yl-5-phenylimidazol-2-yl]-4,5-diphenylimidazole.
| Compound Name | 2-(2-chlorophenyl)-1-[2-(2-chlorophenyl)-4-hexa-1,3,5-trien-3-yl-5-phenylimidazol-2-yl]-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 123828020 |
| Molecular Formula | C42H30Cl2N4 |
| Molecular Weight | 661.64 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[2-(2-chlorophenyl)-4-hexa-1,3,5-trien-3-yl-5-phenylimidazol-2-yl]-4,5-diphenylimidazole |
| SMILES | C=CC=C(C=C)C1=NC(c2ccccc2Cl)(n2c(-c3ccccc3Cl)nc(-c3ccccc3)c2-c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C42H30Cl2N4/c1-3-18-29(4-2)37-38(30-19-8-5-9-20-30)47-42(46-37,34-26-15-17-28-36(34)44)48-40(32-23-12-7-13-24-32)39(31-21-10-6-11-22-31)45-41(48)33-25-14-16-27-35(33)43/h3-28H,1-2H2 |
| InChIKey | YWADTMISWRMXTM-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.64 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|