About [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate
[2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate (PubChem CID 150918707) has the molecular formula C24H17ClN2O3
and a molecular weight of 416.86 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate.
Molecular Properties
| Compound Name | [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate |
| PubChem CID | 150918707 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)On1c(-c2ccccc2Cl)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C24H17ClN2O3/c1-16(28)24(29)30-27-22(18-12-6-3-7-13-18)21(17-10-4-2-5-11-17)26-23(27)19-14-8-9-15-20(19)25/h2-15H,1H3 |
| InChIKey | LDOCKIYEVBFNKS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate?
The IUPAC name of [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate (CID 150918707) is [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate.
What is the SMILES notation for [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate?
The canonical SMILES for [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate is CC(=O)C(=O)On1c(-c2ccccc2Cl)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate?
The InChIKey is LDOCKIYEVBFNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17ClN2O3/c1-16(28)24(29)30-27-22(18-12-6-3-7-13-18)21(17-10-4-2-5-11-17)26-23(27)19-14-8-9-15-20(19)25/h2-15H,1H3.
What are the key properties of [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate?
[2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate has a molecular weight of 416.86 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chlorophenyl)-4,5-diphenylimidazol-1-yl] 2-oxopropanoate is sourced from PubChem (CID 150918707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).