C30H35N5O2S — CID 123828422
N-[(2E,5Z)-2-cyanohepta-2,5-dien-4-ylidene]-2-[3-[(6-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)carbamoyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 123828422) has the molecular formula C30H35N5O2S and a molecular weight of 529.71 g/mol. Its IUPAC name is N-[(2E,5Z)-2-cyanohepta-2,5-dien-4-ylidene]-2-[3-[(6-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)carbamoyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(2E,5Z)-2-cyanohepta-2,5-dien-4-ylidene]-2-[3-[(6-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)carbamoyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 123828422 |
| Molecular Formula | C30H35N5O2S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | N-[(2E,5Z)-2-cyanohepta-2,5-dien-4-ylidene]-2-[3-[(6-ethyl-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-yl)carbamoyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | C/C=C\C(/C=C(\C)C#N)=NC(=O)N1CCCC1c1cccc(C(=O)Nc2nc3c(s2)CCC(CC)CC3)c1 |
| InChI | InChI=1S/C30H35N5O2S/c1-4-8-24(17-20(3)19-31)32-30(37)35-16-7-11-26(35)22-9-6-10-23(18-22)28(36)34-29-33-25-14-12-21(5-2)13-15-27(25)38-29/h4,6,8-10,17-18,21,26H,5,7,11-16H2,1-3H3,(H,33,34,36)/b8-4-,20-17+,32-24? |
| InChIKey | WWZXGWOEZKCJPZ-MCTNUOOCSA-N |
| XLogP | 7.04 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|