2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid

C13H18N2O5S — CID 123828781

IUPAC2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid
SMILESO=C(O)N1CCCOC(CNS(=O)(=O)c2ccccc2)C1
InChIInChI=1S/C13H18N2O5S/c16-13(17)15-7-4-8-20-11(10-15)9-14-21(18,19)12-5-2-1-3-6-12/h1-3,5-6,11,14H,4,7-10H2,(H,16,17)
InChIKeyBPYIRFCZFWQXCQ-UHFFFAOYSA-N
MW314.36 g/mol
LogP0.73
Rot. Bonds4

About 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid

2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid (PubChem CID 123828781) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid.

Molecular Properties

Compound Name2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid
PubChem CID123828781
Molecular FormulaC13H18N2O5S
Molecular Weight314.36 g/mol
Exact Mass314.09
IUPAC Name2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid
SMILESO=C(O)N1CCCOC(CNS(=O)(=O)c2ccccc2)C1
InChIInChI=1S/C13H18N2O5S/c16-13(17)15-7-4-8-20-11(10-15)9-14-21(18,19)12-5-2-1-3-6-12/h1-3,5-6,11,14H,4,7-10H2,(H,16,17)
InChIKeyBPYIRFCZFWQXCQ-UHFFFAOYSA-N
XLogP0.73
TPSA95.94 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.36
LogP ≤ 50.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid?
The IUPAC name of 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid (CID 123828781) is 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid.
What is the SMILES notation for 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid?
The canonical SMILES for 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid is O=C(O)N1CCCOC(CNS(=O)(=O)c2ccccc2)C1.
What is the InChIKey of 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid?
The InChIKey is BPYIRFCZFWQXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O5S/c16-13(17)15-7-4-8-20-11(10-15)9-14-21(18,19)12-5-2-1-3-6-12/h1-3,5-6,11,14H,4,7-10H2,(H,16,17).
What are the key properties of 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid?
2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid has a molecular weight of 314.36 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonamidomethyl)-1,4-oxazepane-4-carboxylic acid is sourced from PubChem (CID 123828781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).