C17H24N4O3 — CID 123829103
3-imino-N,2-dimethyl-2-(methylamino)-3-[4-(morpholine-4-carbonyl)phenyl]propanamide (PubChem CID 123829103) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-imino-N,2-dimethyl-2-(methylamino)-3-[4-(morpholine-4-carbonyl)phenyl]propanamide.
| Compound Name | 3-imino-N,2-dimethyl-2-(methylamino)-3-[4-(morpholine-4-carbonyl)phenyl]propanamide |
|---|---|
| PubChem CID | 123829103 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-imino-N,2-dimethyl-2-(methylamino)-3-[4-(morpholine-4-carbonyl)phenyl]propanamide |
| SMILES | [H]/N=C(\c1ccc(C(=O)N2CCOCC2)cc1)C(C)(NC)C(=O)NC |
| InChI | InChI=1S/C17H24N4O3/c1-17(20-3,16(23)19-2)14(18)12-4-6-13(7-5-12)15(22)21-8-10-24-11-9-21/h4-7,18,20H,8-11H2,1-3H3,(H,19,23)/b18-14+ |
| InChIKey | SSAUOPOJBHPVFR-NBVRZTHBSA-N |
| XLogP | 0.25 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|