C17H22F2N4O3 — CID 144970226
3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-2-(hydroxyamino)-3-imino-N,2-dimethylpropanamide (PubChem CID 144970226) has the molecular formula C17H22F2N4O3 and a molecular weight of 368.38 g/mol. Its IUPAC name is 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-2-(hydroxyamino)-3-imino-N,2-dimethylpropanamide.
| Compound Name | 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-2-(hydroxyamino)-3-imino-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 144970226 |
| Molecular Formula | C17H22F2N4O3 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]-2-(hydroxyamino)-3-imino-N,2-dimethylpropanamide |
| SMILES | [H]/N=C(\c1ccc(C(=O)N2CCC(F)(F)CC2)cc1)C(C)(NO)C(=O)NC |
| InChI | InChI=1S/C17H22F2N4O3/c1-16(22-26,15(25)21-2)13(20)11-3-5-12(6-4-11)14(24)23-9-7-17(18,19)8-10-23/h3-6,20,22,26H,7-10H2,1-2H3,(H,21,25)/b20-13+ |
| InChIKey | PFASDPQVPURDQK-DEDYPNTBSA-N |
| XLogP | 1.41 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|