C15H15F2N3O3 — CID 72908605
1-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]imidazolidine-2,4-dione (PubChem CID 72908605) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is 1-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72908605 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-[4-(4,4-difluoropiperidine-1-carbonyl)phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccc(C(=O)N3CCC(F)(F)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C15H15F2N3O3/c16-15(17)5-7-19(8-6-15)13(22)10-1-3-11(4-2-10)20-9-12(21)18-14(20)23/h1-4H,5-9H2,(H,18,21,23) |
| InChIKey | XJXHGTGDFFVDDB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|