C21H21N3O4 — CID 72881128
1-[4-[3-hydroxy-3-(2-methylphenyl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 72881128) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[4-[3-hydroxy-3-(2-methylphenyl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-[3-hydroxy-3-(2-methylphenyl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72881128 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 1-[4-[3-hydroxy-3-(2-methylphenyl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccccc1C1(O)CCN(C(=O)c2ccc(N3CC(=O)NC3=O)cc2)C1 |
| InChI | InChI=1S/C21H21N3O4/c1-14-4-2-3-5-17(14)21(28)10-11-23(13-21)19(26)15-6-8-16(9-7-15)24-12-18(25)22-20(24)27/h2-9,28H,10-13H2,1H3,(H,22,25,27) |
| InChIKey | XBIYEHCBUYDMSX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|