C20H20N4O3 — CID 97141855
1-[4-[(3S)-3-phenylpiperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 97141855) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[4-[(3S)-3-phenylpiperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-[(3S)-3-phenylpiperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97141855 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 1-[4-[(3S)-3-phenylpiperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccc(C(=O)N3CCN[C@@H](c4ccccc4)C3)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H20N4O3/c25-18-13-24(20(27)22-18)16-8-6-15(7-9-16)19(26)23-11-10-21-17(12-23)14-4-2-1-3-5-14/h1-9,17,21H,10-13H2,(H,22,25,27)/t17-/m1/s1 |
| InChIKey | UATJQWGUGLMQCR-QGZVFWFLSA-N |
| XLogP | 1.53 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|