C16H18N4O — CID 72886763
(2-methylpyrimidin-5-yl)-(3-phenylpiperazin-1-yl)methanone (PubChem CID 72886763) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (2-methylpyrimidin-5-yl)-(3-phenylpiperazin-1-yl)methanone.
| Compound Name | (2-methylpyrimidin-5-yl)-(3-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 72886763 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2-methylpyrimidin-5-yl)-(3-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1ncc(C(=O)N2CCNC(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C16H18N4O/c1-12-18-9-14(10-19-12)16(21)20-8-7-17-15(11-20)13-5-3-2-4-6-13/h2-6,9-10,15,17H,7-8,11H2,1H3 |
| InChIKey | ISBRPIJWMDOVPB-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |