C17H18N4O — CID 74246738
1-methyl-5-(3-phenylpiperazine-1-carbonyl)pyrrole-3-carbonitrile (PubChem CID 74246738) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-methyl-5-(3-phenylpiperazine-1-carbonyl)pyrrole-3-carbonitrile.
| Compound Name | 1-methyl-5-(3-phenylpiperazine-1-carbonyl)pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 74246738 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-methyl-5-(3-phenylpiperazine-1-carbonyl)pyrrole-3-carbonitrile |
| SMILES | Cn1cc(C#N)cc1C(=O)N1CCNC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H18N4O/c1-20-11-13(10-18)9-16(20)17(22)21-8-7-19-15(12-21)14-5-3-2-4-6-14/h2-6,9,11,15,19H,7-8,12H2,1H3 |
| InChIKey | FJOCEDBAYUGYLV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |