C22H25N3O — CID 97140510
[(3R)-3-phenylpiperazin-1-yl]-(3,4,7-trimethyl-1H-indol-2-yl)methanone (PubChem CID 97140510) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3R)-3-phenylpiperazin-1-yl]-(3,4,7-trimethyl-1H-indol-2-yl)methanone.
| Compound Name | [(3R)-3-phenylpiperazin-1-yl]-(3,4,7-trimethyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 97140510 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | [(3R)-3-phenylpiperazin-1-yl]-(3,4,7-trimethyl-1H-indol-2-yl)methanone |
| SMILES | Cc1ccc(C)c2c(C)c(C(=O)N3CCN[C@H](c4ccccc4)C3)[nH]c12 |
| InChI | InChI=1S/C22H25N3O/c1-14-9-10-15(2)20-19(14)16(3)21(24-20)22(26)25-12-11-23-18(13-25)17-7-5-4-6-8-17/h4-10,18,23-24H,11-13H2,1-3H3/t18-/m0/s1 |
| InChIKey | ILHVHRXSMAXBII-SFHVURJKSA-N |
| XLogP | 3.88 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |