C17H19F2NO — CID 144770880
(4,4-difluoropiperidin-1-yl)-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]methanone (PubChem CID 144770880) has the molecular formula C17H19F2NO and a molecular weight of 291.34 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 144770880 |
| Molecular Formula | C17H19F2NO |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]methanone |
| SMILES | C=C/C(=C\C)c1ccc(C(=O)N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C17H19F2NO/c1-3-13(4-2)14-5-7-15(8-6-14)16(21)20-11-9-17(18,19)10-12-20/h3-8H,1,9-12H2,2H3/b13-4+ |
| InChIKey | RVIJCAFWIDGZHF-YIXHJXPBSA-N |
| XLogP | 4.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|