C28H27F2N2OS+ — CID 143075704
(4,4-difluoropiperidin-1-yl)-[4-[(E)-ethylidene-(3-phenyl-1H-indol-1-ium-1-yl)-λ4-sulfanyl]phenyl]methanone (PubChem CID 143075704) has the molecular formula C28H27F2N2OS+ and a molecular weight of 477.60 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[4-[(E)-ethylidene-(3-phenyl-1H-indol-1-ium-1-yl)-λ4-sulfanyl]phenyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[4-[(E)-ethylidene-(3-phenyl-1H-indol-1-ium-1-yl)-λ4-sulfanyl]phenyl]methanone |
|---|---|
| PubChem CID | 143075704 |
| Molecular Formula | C28H27F2N2OS+ |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[4-[(E)-ethylidene-(3-phenyl-1H-indol-1-ium-1-yl)-λ4-sulfanyl]phenyl]methanone |
| SMILES | C/C=S(\c1ccc(C(=O)N2CCC(F)(F)CC2)cc1)[NH+]1C=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H26F2N2OS/c1-2-34(23-14-12-22(13-15-23)27(33)31-18-16-28(29,30)17-19-31)32-20-25(21-8-4-3-5-9-21)24-10-6-7-11-26(24)32/h2-15,20H,16-19H2,1H3/p+1 |
| InChIKey | GGTDBJATCSZPJZ-UHFFFAOYSA-O |
| XLogP | 5.54 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|