C24H21ClF2N2O — CID 126602273
[4-[4-amino-3-(3-chlorophenyl)phenyl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 126602273) has the molecular formula C24H21ClF2N2O and a molecular weight of 426.89 g/mol. Its IUPAC name is [4-[4-amino-3-(3-chlorophenyl)phenyl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | [4-[4-amino-3-(3-chlorophenyl)phenyl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 126602273 |
| Molecular Formula | C24H21ClF2N2O |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [4-[4-amino-3-(3-chlorophenyl)phenyl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | Nc1ccc(-c2ccc(C(=O)N3CCC(F)(F)CC3)cc2)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H21ClF2N2O/c25-20-3-1-2-19(14-20)21-15-18(8-9-22(21)28)16-4-6-17(7-5-16)23(30)29-12-10-24(26,27)11-13-29/h1-9,14-15H,10-13,28H2 |
| InChIKey | GGSYPPBDZOIBPA-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|