C36H32Cl2F2N4O3 — CID 144770745
(E)-3-(6-amino-3-pyridinyl)prop-2-enal;[4-[7-(3,5-dichlorophenyl)-2-(methylaminomethyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 144770745) has the molecular formula C36H32Cl2F2N4O3 and a molecular weight of 677.58 g/mol. Its IUPAC name is (E)-3-(6-amino-3-pyridinyl)prop-2-enal;[4-[7-(3,5-dichlorophenyl)-2-(methylaminomethyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | (E)-3-(6-amino-3-pyridinyl)prop-2-enal;[4-[7-(3,5-dichlorophenyl)-2-(methylaminomethyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 144770745 |
| Molecular Formula | C36H32Cl2F2N4O3 |
| Molecular Weight | 677.58 g/mol |
| Exact Mass | 676.18 |
| IUPAC Name | (E)-3-(6-amino-3-pyridinyl)prop-2-enal;[4-[7-(3,5-dichlorophenyl)-2-(methylaminomethyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | CNCc1cc2cc(-c3ccc(C(=O)N4CCC(F)(F)CC4)cc3)cc(-c3cc(Cl)cc(Cl)c3)c2o1.Nc1ccc(/C=C/C=O)cn1 |
| InChI | InChI=1S/C28H24Cl2F2N2O2.C8H8N2O/c1-33-16-24-13-21-10-19(14-25(26(21)36-24)20-11-22(29)15-23(30)12-20)17-2-4-18(5-3-17)27(35)34-8-6-28(31,32)7-9-34;9-8-4-3-7(6-10-8)2-1-5-11/h2-5,10-15,33H,6-9,16H2,1H3;1-6H,(H2,9,10)/b;2-1+ |
| InChIKey | LBFFCSDBLZQOGG-WLHGVMLRSA-N |
| XLogP | 8.54 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.58 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|