C28H24F2N2O3 — CID 126611358
N-[[5-[4-(3,3-difluoropyrrolidine-1-carbonyl)phenyl]-7-(4-methylphenyl)-1-benzofuran-2-yl]methyl]formamide (PubChem CID 126611358) has the molecular formula C28H24F2N2O3 and a molecular weight of 474.51 g/mol. Its IUPAC name is N-[[5-[4-(3,3-difluoropyrrolidine-1-carbonyl)phenyl]-7-(4-methylphenyl)-1-benzofuran-2-yl]methyl]formamide.
| Compound Name | N-[[5-[4-(3,3-difluoropyrrolidine-1-carbonyl)phenyl]-7-(4-methylphenyl)-1-benzofuran-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 126611358 |
| Molecular Formula | C28H24F2N2O3 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[[5-[4-(3,3-difluoropyrrolidine-1-carbonyl)phenyl]-7-(4-methylphenyl)-1-benzofuran-2-yl]methyl]formamide |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C(=O)N4CCC(F)(F)C4)cc3)cc3cc(CNC=O)oc23)cc1 |
| InChI | InChI=1S/C28H24F2N2O3/c1-18-2-4-20(5-3-18)25-14-22(12-23-13-24(15-31-17-33)35-26(23)25)19-6-8-21(9-7-19)27(34)32-11-10-28(29,30)16-32/h2-9,12-14,17H,10-11,15-16H2,1H3,(H,31,33) |
| InChIKey | OOICEHQUSWXHRT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|