C30H29F3N2O2 — CID 145262537
[4-[2-(2-aminoethyl)-7-(4-fluorophenyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone;ethene (PubChem CID 145262537) has the molecular formula C30H29F3N2O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is [4-[2-(2-aminoethyl)-7-(4-fluorophenyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone;ethene.
| Compound Name | [4-[2-(2-aminoethyl)-7-(4-fluorophenyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone;ethene |
|---|---|
| PubChem CID | 145262537 |
| Molecular Formula | C30H29F3N2O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [4-[2-(2-aminoethyl)-7-(4-fluorophenyl)-1-benzofuran-5-yl]phenyl]-(4,4-difluoropiperidin-1-yl)methanone;ethene |
| SMILES | C=C.NCCc1cc2cc(-c3ccc(C(=O)N4CCC(F)(F)CC4)cc3)cc(-c3ccc(F)cc3)c2o1 |
| InChI | InChI=1S/C28H25F3N2O2.C2H4/c29-23-7-5-19(6-8-23)25-17-21(15-22-16-24(9-12-32)35-26(22)25)18-1-3-20(4-2-18)27(34)33-13-10-28(30,31)11-14-33;1-2/h1-8,15-17H,9-14,32H2;1-2H2 |
| InChIKey | YVJRNOUBIGWEEF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|