C13H16ClF2N2O4S- — CID 158838647
2-chloro-5-(4,4-difluoropiperidine-1-carbonyl)benzenesulfinate;N-methylhydroxylamine (PubChem CID 158838647) has the molecular formula C13H16ClF2N2O4S- and a molecular weight of 369.80 g/mol. Its IUPAC name is 2-chloro-5-(4,4-difluoropiperidine-1-carbonyl)benzenesulfinate;N-methylhydroxylamine.
| Compound Name | 2-chloro-5-(4,4-difluoropiperidine-1-carbonyl)benzenesulfinate;N-methylhydroxylamine |
|---|---|
| PubChem CID | 158838647 |
| Molecular Formula | C13H16ClF2N2O4S- |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-chloro-5-(4,4-difluoropiperidine-1-carbonyl)benzenesulfinate;N-methylhydroxylamine |
| SMILES | CNO.O=C(c1ccc(Cl)c(S(=O)[O-])c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C12H12ClF2NO3S.CH5NO/c13-9-2-1-8(7-10(9)20(18)19)11(17)16-5-3-12(14,15)4-6-16;1-2-3/h1-2,7H,3-6H2,(H,18,19);2-3H,1H3/p-1 |
| InChIKey | NBUSJFJYCFUPLT-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|