C16H19ClF2N2O3 — CID 118786429
propan-2-yl 4-chloro-3-[(4,4-difluoropiperidine-1-carbonyl)amino]benzoate (PubChem CID 118786429) has the molecular formula C16H19ClF2N2O3 and a molecular weight of 360.79 g/mol. Its IUPAC name is propan-2-yl 4-chloro-3-[(4,4-difluoropiperidine-1-carbonyl)amino]benzoate.
| Compound Name | propan-2-yl 4-chloro-3-[(4,4-difluoropiperidine-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 118786429 |
| Molecular Formula | C16H19ClF2N2O3 |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | propan-2-yl 4-chloro-3-[(4,4-difluoropiperidine-1-carbonyl)amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(Cl)c(NC(=O)N2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C16H19ClF2N2O3/c1-10(2)24-14(22)11-3-4-12(17)13(9-11)20-15(23)21-7-5-16(18,19)6-8-21/h3-4,9-10H,5-8H2,1-2H3,(H,20,23) |
| InChIKey | YGHDGXQLFPKXJK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |