C15H17ClN2O3 — CID 95046268
propan-2-yl 4-chloro-3-[[(2R)-2,5-dihydro-1H-pyrrole-2-carbonyl]amino]benzoate (PubChem CID 95046268) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is propan-2-yl 4-chloro-3-[[(2R)-2,5-dihydro-1H-pyrrole-2-carbonyl]amino]benzoate.
| Compound Name | propan-2-yl 4-chloro-3-[[(2R)-2,5-dihydro-1H-pyrrole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 95046268 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | propan-2-yl 4-chloro-3-[[(2R)-2,5-dihydro-1H-pyrrole-2-carbonyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(Cl)c(NC(=O)[C@H]2C=CCN2)c1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-9(2)21-15(20)10-5-6-11(16)13(8-10)18-14(19)12-4-3-7-17-12/h3-6,8-9,12,17H,7H2,1-2H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | SKYMZCHIHGVRNU-GFCCVEGCSA-N |
| XLogP | 2.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|