C20H27F3N2O3Si — CID 123829342
2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-prop-2-enoxy-1-[4-(trifluoromethyl)-2-pyridinyl]-2H-pyrrol-5-one (PubChem CID 123829342) has the molecular formula C20H27F3N2O3Si and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-prop-2-enoxy-1-[4-(trifluoromethyl)-2-pyridinyl]-2H-pyrrol-5-one.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-prop-2-enoxy-1-[4-(trifluoromethyl)-2-pyridinyl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 123829342 |
| Molecular Formula | C20H27F3N2O3Si |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-3-prop-2-enoxy-1-[4-(trifluoromethyl)-2-pyridinyl]-2H-pyrrol-5-one |
| SMILES | C=CCOC1=C(C)C(=O)N(c2cc(C(F)(F)F)ccn2)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H27F3N2O3Si/c1-8-11-27-16-13(2)17(26)25(18(16)28-29(6,7)19(3,4)5)15-12-14(9-10-24-15)20(21,22)23/h8-10,12,18H,1,11H2,2-7H3 |
| InChIKey | VHMPNCDOPMZOKM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|