C21H18N5O5S+ — CID 123834787
[3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-methoxy-oxoazanium (PubChem CID 123834787) has the molecular formula C21H18N5O5S+ and a molecular weight of 452.47 g/mol. Its IUPAC name is [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-methoxy-oxoazanium.
| Compound Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 123834787 |
| Molecular Formula | C21H18N5O5S+ |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1cc(-c2nc(SCC(=O)O)n[nH]2)cc(-c2c(-c3ccccc3)noc2C)c1 |
| InChI | InChI=1S/C21H17N5O5S/c1-12-18(19(25-31-12)13-6-4-3-5-7-13)14-8-15(10-16(9-14)26(29)30-2)20-22-21(24-23-20)32-11-17(27)28/h3-10H,11H2,1-2H3,(H-,22,23,24,27,28)/p+1 |
| InChIKey | FNWQHLKNUIPCAA-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|