C18H14FN3O — CID 123834880
1-ethyl-5-(4-fluorophenoxy)-3-(3-isocyanophenyl)pyrazole (PubChem CID 123834880) has the molecular formula C18H14FN3O and a molecular weight of 307.33 g/mol. Its IUPAC name is 1-ethyl-5-(4-fluorophenoxy)-3-(3-isocyanophenyl)pyrazole.
| Compound Name | 1-ethyl-5-(4-fluorophenoxy)-3-(3-isocyanophenyl)pyrazole |
|---|---|
| PubChem CID | 123834880 |
| Molecular Formula | C18H14FN3O |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-ethyl-5-(4-fluorophenoxy)-3-(3-isocyanophenyl)pyrazole |
| SMILES | [C-]#[N+]c1cccc(-c2cc(Oc3ccc(F)cc3)n(CC)n2)c1 |
| InChI | InChI=1S/C18H14FN3O/c1-3-22-18(23-16-9-7-14(19)8-10-16)12-17(21-22)13-5-4-6-15(11-13)20-2/h4-12H,3H2,1H3 |
| InChIKey | IINZTYHGGHTDDF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 31.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|